![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | mrbook.pdf | 2013-03-29 00:29 | 34M | |
![[ ]](/icons/layout.gif) | Rai-1611163.pdf | 2015-06-05 10:56 | 16M | |
![[ ]](/icons/layout.gif) | Electrochemical Study of DNA Damaged by Oxidation Stress.pdf | 2013-04-03 12:57 | 12M | |
![[ ]](/icons/layout.gif) | Zoonazy_Ludmila_Krejcova.pdf | 2015-11-24 13:48 | 6.9M | |
![[ ]](/icons/layout.gif) | 978-1-63482-248-0_eBook.pdf | 2015-05-11 14:41 | 6.3M | |
![[ ]](/icons/layout.gif) | Complete_Microchip_Capillary_Electrophoresis.pdf | 2015-05-11 14:41 | 6.0M | |
![[ ]](/icons/layout.gif) | Sulfur mustard causes oxidative stress and depletion of antioxi.pdf | 2014-01-14 09:03 | 5.7M | |
![[ ]](/icons/layout.gif) | atmosphere-06-01290.pdf | 2015-08-31 11:26 | 5.7M | |
![[ ]](/icons/layout.gif) | Deoxynivalenol and its toxicity.pdf | 2011-11-21 11:28 | 5.7M | |
![[ ]](/icons/layout.gif) | Kizek from 978-1-62948-057-2.pdf | 2013-11-09 19:19 | 5.6M | |
![[ ]](/icons/layout.gif) | materials-08-02994.pdf | 2015-06-01 16:21 | 5.0M | |
![[ ]](/icons/layout.gif) | mjrd.pdf | 2012-08-08 10:40 | 4.8M | |
![[ ]](/icons/layout.gif) | Metalothionein a jeho role v detoxikaci těžkých kovů a predispozici k chorobám.pdf | 2012-08-08 10:40 | 4.8M | |
![[ ]](/icons/layout.gif) | srep08868_hEGER.pdf | 2015-03-16 15:01 | 4.6M | |
![[ ]](/icons/layout.gif) | automated assay.pdf | 2012-05-02 19:24 | 3.9M | |
![[ ]](/icons/layout.gif) | mvpub.pdf | 2015-03-26 10:27 | 3.6M | |
![[ ]](/icons/layout.gif) | Trnkova_s8095619.pdf | 2011-12-01 15:18 | 3.6M | |
![[ ]](/icons/layout.gif) | Rene-Kizek.pdf | 2014-12-01 09:44 | 3.5M | |
![[ ]](/icons/layout.gif) | Rene Kizek.pdf | 2014-12-01 09:44 | 3.5M | |
![[ ]](/icons/layout.gif) | Raudenska et al_2013_MRMC_final.pdf | 2014-01-06 15:55 | 3.5M | |
![[ ]](/icons/layout.gif) | adam-7-titulni-strana.pdf | 2013-03-27 12:53 | 3.4M | |
![[ ]](/icons/layout.gif) | ijms-15-22960-1112.pdf | 2014-12-12 10:09 | 3.4M | |
![[ ]](/icons/layout.gif) | 0005F.pdf | 2013-06-21 12:16 | 3.4M | |
![[ ]](/icons/layout.gif) | The Study of Naphthoquinones and Their Complexes with DNA by Using Raman Spectroscopy.pdf | 2014-06-24 09:05 | 3.4M | |
![[ ]](/icons/layout.gif) | Mathematical Evaluation of the Amino Acid and Polyphenol.pdf | 2011-09-02 09:49 | 3.3M | |
![[ ]](/icons/layout.gif) | KRAS NF-kB is involved in the development of zinc resistance and reduced curability in prostate cancer - Moving along the axis of evil.pdf | 2014-06-26 09:00 | 3.3M | |
![[ ]](/icons/layout.gif) | patentova-listina-108.pdf | 2012-10-08 15:51 | 3.1M | |
![[ ]](/icons/layout.gif) | pATENTOVÁ LISTINA 108.pdf | 2012-10-08 15:51 | 3.1M | |
![[ ]](/icons/layout.gif) | metodika-5.pdf | 2013-03-27 14:37 | 3.1M | |
![[ ]](/icons/layout.gif) | FEBS Journal_Volume 281.pdf | 2014-10-02 09:24 | 2.9M | |
![[ ]](/icons/layout.gif) | 08jsen00-stejskal-proof.pdf | 2011-12-01 15:30 | 2.7M | |
![[ ]](/icons/layout.gif) | Chem_tox.pdf | 2012-06-24 22:31 | 2.7M | |
![[ ]](/icons/layout.gif) | pub2015.pdf | 2014-10-28 15:29 | 2.6M | |
![[ ]](/icons/layout.gif) | Sobrova_platina.pdf | 2012-08-07 07:17 | 2.5M | |
![[ ]](/icons/layout.gif) | sensors-15-00592.pdf | 2014-12-30 14:04 | 2.5M | |
![[ ]](/icons/layout.gif) | Pharmaceutical importance of zinc and metallothionein in cell signalling.pdf | 2011-11-22 15:13 | 2.5M | |
![[ ]](/icons/layout.gif) | Effects of cadmium(II) ions on early somatic embryos of Norway spruce studied by using electrochemical techniques and nuclear magnetic resonance.pdf | 2011-11-21 15:02 | 2.4M | |
![[ ]](/icons/layout.gif) | Masarik et al 2012.pdf | 2012-05-31 23:53 | 2.4M | |
![[ ]](/icons/layout.gif) | clanek1014.pdf | 2014-09-03 08:53 | 2.4M | |
![[ ]](/icons/layout.gif) | sensors-14-22982.pdf | 2014-12-07 16:17 | 2.3M | |
![[ ]](/icons/layout.gif) | MZLU_mendel-green_3_2010-WEB.pdf | 2011-06-26 16:47 | 2.3M | |
![[ ]](/icons/layout.gif) | dasa728.pdf | 2013-12-16 16:33 | 2.3M | |
![[ ]](/icons/layout.gif) | Mammalian metallothioneins properties and functions.pdf | 2012-07-27 07:39 | 2.2M | |
![[ ]](/icons/layout.gif) | ijms-16-24656.pdf | 2015-10-20 14:16 | 2.1M | |
![[ ]](/icons/layout.gif) | Trithiocyanurate Complexes of Iron, Manganese and Nickel and Their Anticholinesterase Activity.pdf | 2014-04-10 08:38 | 2.0M | |
![[ ]](/icons/layout.gif) | Automated nucleic acids isolation using paramagnetic microparticles coupled.pdf | 2011-11-23 11:14 | 2.0M | |
![[ ]](/icons/layout.gif) | Nanoscale Copper_N.A. Anjum et al. (2015) Environmental Research.pdf | 2015-03-05 18:03 | 2.0M | |
![[ ]](/icons/layout.gif) | DNA interaction with zinc(II) ions.pdf | 2013-12-30 11:55 | 2.0M | |
![[ ]](/icons/layout.gif) | Investigation of interaction between magnetic silica particles and lambda phage DNA fragment.pdf | 2013-09-19 08:56 | 1.9M | |
![[ ]](/icons/layout.gif) | Study of Functional Qualities of Different Types of Tailored.pdf | 2014-06-29 13:27 | 1.8M | |
![[ ]](/icons/layout.gif) | Identification of quantum dots labeled metallothionein by fast scanning laser-induced breakdown spectroscopy.pdf | 2014-10-03 09:33 | 1.8M | |
![[ ]](/icons/layout.gif) | 1-s2.0-S0944501314000895-main.pdf | 2014-12-07 16:18 | 1.8M | |
![[ ]](/icons/layout.gif) | SAB_Kaiser_09.pdf | 2011-06-26 17:02 | 1.8M | |
![[ ]](/icons/layout.gif) | KIZEK2_PH_AN_Revised.pdf | 2011-11-22 14:51 | 1.7M | |
![[ ]](/icons/layout.gif) | Are_Early_Somatic_Embryos.pdf | 2015-12-07 11:23 | 1.7M | |
![[ ]](/icons/layout.gif) | Apoferritin Modified Magnetic Particles as Doxorubicin.pdf | 2013-06-28 07:57 | 1.7M | |
![[ ]](/icons/layout.gif) | Environ_Exp_Bot_Babula.pdf | 2012-07-06 11:40 | 1.7M | |
![[ ]](/icons/layout.gif) | Raudenska et al 2014.pdf | 2013-12-20 08:52 | 1.7M | |
![[ ]](/icons/layout.gif) | MALDI-TOF MS as evolving cancer diagnostic tool.pdf | 2014-04-02 10:12 | 1.7M | |
![[ ]](/icons/layout.gif) | sensors-14-17725.pdf | 2014-09-23 14:21 | 1.7M | |
![[ ]](/icons/layout.gif) | selenium_sochor.pdf | 2012-08-07 07:17 | 1.7M | |
![[ ]](/icons/layout.gif) | Phys Res 2009.pdf | 2011-11-23 17:08 | 1.6M | |
![[ ]](/icons/layout.gif) | NDD-56771-nanoscale-virus-biosensors.pdf | 2015-09-03 09:59 | 1.6M | |
![[ ]](/icons/layout.gif) | 10.1007_s10337-014-2733-6.pdf | 2014-11-10 17:02 | 1.6M | |
![[ ]](/icons/layout.gif) | clanek107.pdf | 2015-07-14 14:56 | 1.6M | |
![[ ]](/icons/layout.gif) | The Role of Metallothionein in Oxidative Stress.pdf | 2013-03-15 12:48 | 1.6M | |
![[ ]](/icons/layout.gif) | Content of Phenolic Compounds and Antioxidant Capacity in.pdf | 2011-06-26 16:50 | 1.6M | |
![[ ]](/icons/layout.gif) | Microarray Analysis MTpdf.pdf | 2015-11-09 08:57 | 1.5M | |
![[ ]](/icons/layout.gif) | Investigation into the Effect of Molds in Grasses on Their Content of Low Molecular Mass Thiols.pdf | 2012-10-24 14:29 | 1.4M | |
![[ ]](/icons/layout.gif) | Nejdl_et_al-2015-ELECTROPHORESIS.pdf | 2015-09-15 15:47 | 1.3M | |
![[ ]](/icons/layout.gif) | Behaviour of Zinc Complexes and Zinc Sulphide Nanoparticles Revealed by Using Screen Printed Electrodes and Spectrometry.pdf | 2013-10-25 13:37 | 1.3M | |
![[ ]](/icons/layout.gif) | 10.1007_s10337-014-2732-7.pdf | 2014-11-10 17:00 | 1.3M | |
![[ ]](/icons/layout.gif) | 10.1007_s10337-014-2731-8.pdf | 2014-11-10 17:05 | 1.3M | |
![[ ]](/icons/layout.gif) | pub_molecules-20-10360.pdf | 2015-06-04 16:12 | 1.3M | |
![[ ]](/icons/layout.gif) | Krizkova_sens_08.pdf | 2011-06-26 17:28 | 1.3M | |
![[ ]](/icons/layout.gif) | PCS_Metodika_31-036-9000-b.pdf | 2012-12-28 10:28 | 1.2M | |
![[ ]](/icons/layout.gif) | Study of Streptavidin-Modified Quantum Dots by Capillary.pdf | 2013-04-02 08:13 | 1.2M | |
![[ ]](/icons/layout.gif) | krizkovaPUB.pdf | 2015-05-26 09:08 | 1.2M | |
![[ ]](/icons/layout.gif) | Paramagnetic particles coupled with an automated flow injection analysis.pdf | 2012-10-29 20:33 | 1.2M | |
![[ ]](/icons/layout.gif) | mv-book.pdf | 2015-07-15 14:58 | 1.2M | |
![[ ]](/icons/layout.gif) | Bioelectrochem_1.pdf | 2011-06-30 18:23 | 1.2M | |
![[ ]](/icons/layout.gif) | Nano_based_drug_delivery_00.pdf | 2015-07-22 10:06 | 1.2M | |
![[ ]](/icons/layout.gif) | Glutathione modified CdTe quantum dots as a label for studying DNA interactions with platinum based cytostatics.pdf | 2013-03-14 21:03 | 1.2M | |
![[ ]](/icons/layout.gif) | Sochor et al.pdf | 2012-03-25 20:15 | 1.2M | |
![[ ]](/icons/layout.gif) | OP_1_05.pdf | 2011-06-30 17:55 | 1.1M | |
![[ ]](/icons/layout.gif) | Investigating the influence of taurine on thiol antioxidant.pdf | 2014-04-09 14:54 | 1.1M | |
![[ ]](/icons/layout.gif) | 06_10.1586.ERP.13.21.pdf | 2013-07-16 08:08 | 1.1M | |
![[ ]](/icons/layout.gif) | Spectrometric and Chromatographic Study of Reactive Oxidants.pdf | 2013-04-02 08:13 | 1.1M | |
![[ ]](/icons/layout.gif) | Copper Transport and Accumulation in Spruce Stems (Picea.pdf | 2013-04-05 07:58 | 1.1M | |
![[ ]](/icons/layout.gif) | Immunoextraction of zinc proteins from human plasma using chicken yolk antibodies immobilized onto paramagnetic par.pdf | 2012-06-29 23:08 | 1.1M | |
![[ ]](/icons/layout.gif) | Optimization of Planar Three-Electrode Systems for Redox System Detection.pdf | 2012-03-03 19:54 | 1.1M | |
![[ ]](/icons/layout.gif) | Gumulec et al 2014_PLOS.pdf | 2014-01-09 14:25 | 1.1M | |
![[ ]](/icons/layout.gif) | Influence of Zinc(II) and Copper(II) Ions on Streptomyces Bacteria Revealed by Electrochemistry.pdf | 2011-11-18 14:21 | 1.1M | |
![[ ]](/icons/layout.gif) | elps5237.pdf | 2015-02-06 09:39 | 1.1M | |
![[ ]](/icons/layout.gif) | Antioxidacni aktivita_brozura.pdf | 2012-05-16 02:25 | 1.1M | |
![[ ]](/icons/layout.gif) | Antioxidacni aktivita_brožura.pdf | 2012-07-06 13:34 | 1.1M | |
![[ ]](/icons/layout.gif) | Antioxidacni -aktivita.pdf | 2012-07-06 13:34 | 1.1M | |
![[ ]](/icons/layout.gif) | Electrochemical Microsensors for the Detection of Cadmium(II) and Lead(II) Ions in Plants.pdf | 2011-06-26 16:56 | 1.1M | |
![[ ]](/icons/layout.gif) | Electrophoretic and chromatographic.pdf | 2012-08-09 22:20 | 1.1M | |
![[ ]](/icons/layout.gif) | Matrix Metalloproteinases.pdf | 2011-06-26 16:23 | 1.1M | |
![[ ]](/icons/layout.gif) | 1471-2105-14-S10-S1.pdf | 2013-08-26 10:42 | 1.1M | |
![[ ]](/icons/layout.gif) | Microchim_Acta_15.pdf | 2015-05-06 09:20 | 1.1M | |
![[ ]](/icons/layout.gif) | Microchim Acta 15.pdf | 2015-05-11 14:34 | 1.1M | |
![[ ]](/icons/layout.gif) | Comparison of the effects of silver phosphate and selenium nanoparticles on Staphylococcus aureus.pdf | 2014-02-26 08:10 | 1.1M | |
![[ ]](/icons/layout.gif) | From Amino Acids Profile to Protein Identification.pdf | 2014-07-31 13:09 | 1.1M | |
![[ ]](/icons/unknown.gif) | Detection of phytochelatins in flax (Linum usitatissimum l.).PDF | 2011-11-21 11:45 | 1.1M | |
![[ ]](/icons/layout.gif) | Electrochemical detection of mRNA isolated from plant tissues using of paramagnetic microparticles.pdf | 2011-11-21 15:44 | 1.1M | |
![[ ]](/icons/layout.gif) | Jurikova_molecules-17-00061.pdf | 2012-01-14 21:38 | 1.1M | |
![[ ]](/icons/layout.gif) | elps5260.pdf | 2015-01-02 14:59 | 1.0M | |
![[ ]](/icons/unknown.gif) | Protein profiles in plants exposed to ?-hexachlorocyclohexane.PDF | 2011-11-22 15:51 | 1.0M | |
![[ ]](/icons/layout.gif) | P10_Analysis of Cadmium-Phytochelatins 2 Complexes Using Flow.pdf | 2014-03-13 10:48 | 1.0M | |
![[ ]](/icons/layout.gif) | Rapid superparamagnetic-beads-based automated immunoseparation of Zn-proteins from Staphylococcus aureus with nanogram yield.pdf | 2013-01-13 16:20 | 1.0M | |
![[ ]](/icons/layout.gif) | ijms-14-21629.pdf | 2013-11-01 07:31 | 1.0M | |
![[ ]](/icons/unknown.gif) | Toxicity of nanoparticles for plants.PDF | 2011-11-22 17:50 | 1.0M | |
![[ ]](/icons/layout.gif) | Bio-Sensing of Cadmium(II) Ions Using Staphylococcus aureus.pdf | 2011-11-15 15:50 | 1.0M | |
![[ ]](/icons/unknown.gif) | An utilizing of laser induced breakdown spectroscopy for metal ions detection.PDF | 2011-11-22 18:08 | 1.0M | |
![[ ]](/icons/unknown.gif) | An assay for spectrometric determination of antioxidant activity of a biological extract.PDF | 2011-11-18 16:54 | 1.0M | |
![[ ]](/icons/unknown.gif) | High performance liquid chromatographic assay for detection of phytochelatinsynthase.PDF | 2011-11-21 16:53 | 1.0M | |
![[ ]](/icons/unknown.gif) | A study of availability of heavy metal ions by using various extraction procedures and electrochemical detection.PDF | 2011-11-22 17:17 | 1.0M | |
![[ ]](/icons/unknown.gif) | Biosensors for detection of heavy metals.PDF | 2011-11-21 09:58 | 1.0M | |
![[ ]](/icons/unknown.gif) | The importance and effects of copper on plants.PDF | 2011-11-22 14:11 | 1.0M | |
![[ ]](/icons/unknown.gif) | Remediation potential of bacteria for removing heavy metals from environment.PDF | 2011-11-22 16:48 | 1.0M | |
![[ ]](/icons/unknown.gif) | Effect of cadmium (II) ions on sunflower callus culture.PDF | 2011-11-21 13:28 | 1.0M | |
![[ ]](/icons/unknown.gif) | Transcriptomic to assess the effect of heavy metals on plants.PDF | 2011-11-22 17:58 | 1.0M | |
![[ ]](/icons/unknown.gif) | A study of tolerance of flax to cadmium(II) ions.PDF | 2011-11-22 17:27 | 1.0M | |
![[ ]](/icons/layout.gif) | Oxidative Stress in Staphylococcus aureus Treated with Silver(I).pdf | 2013-04-05 07:57 | 1.0M | |
![[ ]](/icons/unknown.gif) | Crops as metal-hyperaccumulators and their using for phytoremediation.PDF | 2011-11-21 11:37 | 1.0M | |
![[ ]](/icons/unknown.gif) | An affecting of soil-plant system by platinum group elements.PDF | 2011-11-18 16:43 | 1.0M | |
![[ ]](/icons/unknown.gif) | Rapid spectrophotometric determination of lanthanum(III) ions in water samples.PDF | 2011-11-22 16:43 | 1.0M | |
![[ ]](/icons/layout.gif) | Effects of redox conditions and zinc(II) ions on metallothionein aggregation revealed by chip capillary electrophoresis.pdf | 2011-06-26 16:44 | 1.0M | |
![[ ]](/icons/layout.gif) | Babula_EEB_09.pdf | 2011-06-26 17:01 | 1.0M | |
![[ ]](/icons/layout.gif) | KIZEK1_PH_AN_Revised.pdf | 2011-11-21 15:51 | 1.0M | |
![[ ]](/icons/layout.gif) | P12_Oxidative Stress in Staphylococcus aureus Treated with Silver(I).pdf | 2014-03-13 10:48 | 1.0M | |
![[ ]](/icons/layout.gif) | 10.1007_s10337-014-2737-2.pdf | 2014-11-10 17:04 | 1.0M | |
![[ ]](/icons/layout.gif) | Effect of Nucleic Acid and Albumin on Luminescence Properties of Deposited TiO2 Quantum Dots.pdf | 2012-03-19 20:34 | 1.0M | |
![[ ]](/icons/layout.gif) | Liposomal nanotransporter for targeted binding based on nucleic acid anchor system.pdf | 2014-07-31 13:10 | 1.0M | |
![[ ]](/icons/layout.gif) | Biotin-modified glutathione as a.pdf | 2011-06-28 14:55 | 1.0M | |
![[ ]](/icons/layout.gif) | Spectrometric and Electrochemical Analysis of Sarcosine as a Potential Prostate Carcinoma Marker.pdf | 2012-05-01 19:09 | 1.0M | |
![[ ]](/icons/layout.gif) | Immobilization of metallothionein to carbon paste electrode surface via anti-MT antibodies and its use for biosensing of silver.pdf | 2011-06-26 16:09 | 1.0M | |
![[ ]](/icons/layout.gif) | Isolation of Xis Gen Fragment of si Phage from Agarose Gel Using Magnetic Particles for Subsequent Enzymatic DNA Sequencing.pdf | 2013-04-02 08:13 | 1.0M | |
![[ ]](/icons/layout.gif) | gumulec_plos_one_2014.pdf | 2014-06-20 10:36 | 1.0M | |
![[ ]](/icons/layout.gif) | elps5203.pdf | 2014-09-08 13:02 | 1.0M | |
![[ ]](/icons/layout.gif) | y-Fe2O3 Magnetic Core Functionalized with Tetraethyl Orthosilicate and 3-Aminopropyl Triethoxysilane for an Isolation of H7N7 Influenza Serotype Virions.pdf | 2014-06-29 13:19 | 1.0M | |
![[ ]](/icons/layout.gif) | ijerph-10-06687.pdf | 2013-12-03 12:02 | 973K | |
![[ ]](/icons/layout.gif) | BIOJEC6199.pdf | 2011-06-26 17:11 | 965K | |
![[ ]](/icons/layout.gif) | JPT6381.pdf | 2012-01-14 21:39 | 961K | |
![[ ]](/icons/layout.gif) | Single Amino Acid Change in Metallothionein Metal-Binding Cluster Influences Interaction with Cisplatin.pdf | 2013-02-11 08:38 | 949K | |
![[ ]](/icons/layout.gif) | ijms-14-13497.pdf | 2013-06-28 09:11 | 938K | |
![[ ]](/icons/layout.gif) | Analysis of metallothionein by capillary electrophoresis.pdf | 2012-02-08 19:40 | 921K | |
![[ ]](/icons/layout.gif) | Analysis of Cadmium-Phytochelatins 2 Complexes Using Flow.pdf | 2013-04-05 07:57 | 917K | |
![[ ]](/icons/layout.gif) | P9_Copper Transport and Accumulation in Spruce Stems (Picea.pdf | 2014-03-13 10:48 | 916K | |
![[ ]](/icons/layout.gif) | Fullerene as a transporter for doxorubicin investigated by analytical methods and in vivo imaging.pdf | 2014-04-04 08:19 | 912K | |
![[ ]](/icons/layout.gif) | INDCRO5887.pdf | 2012-01-14 21:37 | 901K | |
![[ ]](/icons/layout.gif) | 46018.pdf | 2014-06-13 12:30 | 897K | |
![[ ]](/icons/layout.gif) | CSP_2013_6_298_303.pdf | 2014-01-06 09:19 | 895K | |
![[ ]](/icons/layout.gif) | Carbon composite micro- and nano-tubes-based electrodes.pdf | 2011-07-26 12:01 | 887K | |
![[ ]](/icons/layout.gif) | Electrochemical Behaviour of Native and Denatured B-Sheet Breaker Prion Protein.pdf | 2012-02-02 22:05 | 886K | |
![[ ]](/icons/layout.gif) | SharkaThe Past The Present and The Future.pdf | 2012-11-08 16:04 | 878K | |
![[ ]](/icons/layout.gif) | Study of Interaction between Metallothionein and CdTe Quantum.pdf | 2013-04-02 08:13 | 873K | |
![[ ]](/icons/layout.gif) | HAZMAT13197.pdf | 2011-07-14 14:14 | 859K | |
![[ ]](/icons/layout.gif) | Comparison of Various Easy-to-Use Procedures for Extraction of Phenols from Apricot Fruits.pdf | 2011-11-18 12:25 | 858K | |
![[ ]](/icons/layout.gif) | Microfluidic.pdf | 2013-09-15 14:11 | 857K | |
![[ ]](/icons/layout.gif) | Electrochemical Determination of Enzymes Metabolizing Ellipticine in Thyroid Cancer Cells - a Tool to Explain the Mechanism of Ellipticine Toxicity to these Cells.pdf | 2013-02-11 08:38 | 854K | |
![[ ]](/icons/layout.gif) | Spectroscopic and Electrochemical Characterization of CD4 Binding Site of HIV-1 Exterior Envelope gp120.pdf | 2014-06-29 13:19 | 851K | |
![[ ]](/icons/layout.gif) | Voltammetric Characterization of Lawsone-Copper(II) Ternary Complexes and Their Interactions with dsDNA.pdf | 2012-08-02 16:19 | 849K | |
![[ ]](/icons/layout.gif) | 087-092_PRK_0214_Raudenska.pdf | 2014-03-24 15:33 | 846K | |
![[ ]](/icons/layout.gif) | kvadrup.pdf | 2015-05-11 14:34 | 844K | |
![[ ]](/icons/layout.gif) | Determination of Plant Thiols by Liquid Chromatography Coupled with Coulometric and Amperometric Detection in Lettuce Treated by Lead(II) Ions.pdf | 2011-06-26 16:34 | 842K | |
![[ ]](/icons/layout.gif) | manuscript03.pdf | 2015-10-20 14:14 | 832K | |
![[ ]](/icons/layout.gif) | Oncol Rep Vol33 No2 Pg921.pdf | 2014-12-17 12:38 | 829K | |
![[ ]](/icons/layout.gif) | Modern Micro and Nanoparticle-Based Imaging Techniques.pdf | 2012-11-02 14:04 | 823K | |
![[ ]](/icons/layout.gif) | Microfluidic tool coupled with.pdf | 2013-07-18 16:20 | 822K | |
![[ ]](/icons/layout.gif) | elps4782.pdf | 2013-07-04 08:20 | 805K | |
![[ ]](/icons/layout.gif) | A New Approach how to Define.pdf | 2011-07-14 14:58 | 803K | |
![[ ]](/icons/layout.gif) | Tissue Specific Electrochemical Fingerprinting.pdf | 2012-11-22 10:30 | 801K | |
![[ ]](/icons/layout.gif) | Kudr et al 2015.pdf | 2015-03-05 18:02 | 795K | |
![[ ]](/icons/layout.gif) | Photo-cytochrome b5 - A new tool to study the cytochrome P450 electron-transport chain.pdf | 2013-01-04 18:17 | 793K | |
![[ ]](/icons/layout.gif) | Complexes of Silver(I) Ions and Silver Phosphate Nanoparticles.pdf | 2013-07-01 08:01 | 788K | |
![[ ]](/icons/layout.gif) | Fabrik_Electroanal.pdf | 2011-06-26 17:18 | 788K | |
![[ ]](/icons/layout.gif) | Int J Oncol Vol44 No3 Pg923.pdf | 2014-03-24 15:33 | 771K | |
![[ ]](/icons/layout.gif) | Automated Electrochemical Analyzer as a New Tool for Detection of Thiols.pdf | 2011-06-26 16:39 | 763K | |
![[ ]](/icons/unknown.gif) | The impact factor of Listy Cukrovarnicke a Reparske 2009.PDF | 2011-11-22 13:42 | 762K | |
![[ ]](/icons/layout.gif) | Electrochemical and Spectrometric Study of GFP-AZT Interaction.pdf | 2014-06-29 13:20 | 757K | |
![[ ]](/icons/layout.gif) | Separation of Lactoferrin from Human Saliva.pdf | 2013-05-27 11:43 | 757K | |
![[ ]](/icons/layout.gif) | Electrochemical Impedance Spectroscopy Behaviour of Guanine.pdf | 2013-04-05 07:56 | 757K | |
![[ ]](/icons/layout.gif) | Plasmid HIV p24 Gene Detection on Mercury Film Electrode.pdf | 2014-06-29 13:20 | 754K | |
![[ ]](/icons/layout.gif) | 21stolHuska.pdf | 2011-06-26 17:05 | 753K | |
![[ ]](/icons/layout.gif) | 10.1007_s10337-014-2775-9.pdf | 2014-11-10 17:05 | 752K | |
![[ ]](/icons/layout.gif) | Determination of Eight Polycyclic Aromatic Hydrocarbons and in Pea Plants (Pisum sativum L.) Extracts by High Performance Liquid Chromatography with Electrochemical Detection.pdf | 2012-02-02 22:05 | 751K | |
![[ ]](/icons/layout.gif) | Structure, Polymorphisms and Electrochemistry of Mammalian Metallothioneins - A Review.pdf | 2012-12-03 11:43 | 751K | |
![[ ]](/icons/layout.gif) | Oncol Rep Vol28 No3 Pg806.pdf | 2012-07-10 22:44 | 751K | |
![[ ]](/icons/layout.gif) | Influence of Magnetic Microparticles Isolation on Adenine.pdf | 2014-02-26 08:10 | 746K | |
![[ ]](/icons/layout.gif) | Structural changes in metallothionein isoforms revealed by capillary electrophoresis and Brdicka reaction.pdf | 2012-01-14 21:36 | 745K | |
![[ ]](/icons/layout.gif) | OO2954.pdf | 2014-02-10 10:47 | 741K | |
![[ ]](/icons/layout.gif) | Skl__danka.pdf | 2011-06-26 16:54 | 722K | |
![[ ]](/icons/layout.gif) | 434-441.pdf | 2011-06-30 18:16 | 720K | |
![[ ]](/icons/layout.gif) | UV100201696.pdf | 2015-03-03 10:02 | 718K | |
![[ ]](/icons/layout.gif) | Forage as a Primary Source of Mycotoxins in Animal Diets.pdf | 2011-06-26 16:16 | 717K | |
![[ ]](/icons/layout.gif) | Automated Electrochemical Detection of Iron Ions in Erythrocytes from MeLiM Minipigs Suffering from Melanoma.pdf | 2012-07-02 23:14 | 717K | |
![[ ]](/icons/layout.gif) | Capillary electromigration based techniques.pdf | 2012-12-20 12:34 | 715K | |
![[ ]](/icons/layout.gif) | Determination of Metal Ions in the Plasma of Children with.pdf | 2014-06-29 13:27 | 711K | |
![[ ]](/icons/layout.gif) | 10.1007_s10337-014-2734-5.pdf | 2014-11-10 17:02 | 705K | |
![[ ]](/icons/layout.gif) | Paramagnetic Particles Isolation of Influenza Oligonucleotide.pdf | 2013-04-02 08:12 | 705K | |
![[ ]](/icons/layout.gif) | Using of paramagnetic microparticles and quantum dots for isolation and electrochemical detection of influenza viruses' specific nucleic acids.pdf | 2013-01-04 18:17 | 705K | |
![[ ]](/icons/layout.gif) | Study of Interactions between Cysteine and Cadmium(II) Ions using Automatic Pipetting System off-line Coupled with Electrochemical Analyser.pdf | 2012-03-03 19:54 | 703K | |
![[ ]](/icons/layout.gif) | coverJESE.pdf | 2015-07-07 09:13 | 703K | |
![[ ]](/icons/layout.gif) | Zeptomole Electrochemical Detection of Metallothioneins.pdf | 2011-06-26 16:55 | 703K | |
![[ ]](/icons/layout.gif) | Oncol Rep Vol27 No3 Pg831.pdf | 2012-01-14 21:39 | 701K | |
![[ ]](/icons/layout.gif) | Easy to use and rapid isolation and detection of a viral nucleic acid by using paramagnetic microparticles and carbon nanotubes-based screen-printed electrodes.pdf | 2011-06-26 16:49 | 699K | |
![[ ]](/icons/layout.gif) | ijerph-11-03233-manuscript.pdf | 2014-03-17 17:04 | 699K | |
![[ ]](/icons/layout.gif) | Automated Voltammetric Determination of Lead(II) Ions Using.pdf | 2013-04-05 07:57 | 699K | |
![[ ]](/icons/layout.gif) | Electrochemical Behaviour of Apoferritin Encapsulating.pdf | 2012-07-02 23:15 | 697K | |
![[ ]](/icons/layout.gif) | Catalytic Electrochemical Analysis of Platinum in Pt-DNA Adducts.pdf | 2012-04-03 19:57 | 691K | |
![[ ]](/icons/layout.gif) | elps4751.pdf | 2013-07-04 09:32 | 690K | |
![[ ]](/icons/layout.gif) | Microfluidic tool based on the antibody-modified paramagnetic particles.pdf | 2011-11-22 10:43 | 689K | |
![[ ]](/icons/layout.gif) | 3D printed chip for electrochemical detection of influenza virus labeled.pdf | 2013-12-02 09:39 | 685K | |
![[ ]](/icons/layout.gif) | G-Quadruplexes as Sensing Probes.pdf | 2013-11-29 15:11 | 684K | |
![[ ]](/icons/layout.gif) | Interactions of Platinum-Based Cytostatics with Metallothionein.pdf | 2013-04-05 07:57 | 682K | |
![[ ]](/icons/layout.gif) | HAZMAT13832.pdf | 2012-01-14 21:37 | 678K | |
![[ ]](/icons/layout.gif) | Study of DNA-ellipticine interaction by capillary electrop.pdf | 2012-06-28 21:09 | 676K | |
![[ ]](/icons/layout.gif) | Beads-Based Electrochemical Assay for the Detection of Influenza Hemagglutinin Labeled with CdTe Quantum Dots.pdf | 2013-12-17 16:04 | 674K | |
![[ ]](/icons/layout.gif) | Electrochemical Behaviour of Doxorubicin Encapsulated in Apoferritin.pdf | 2013-10-30 07:42 | 674K | |
![[ ]](/icons/layout.gif) | Chapter 3.pdf | 2012-06-04 09:39 | 674K | |
![[ ]](/icons/layout.gif) | Kaiser.pdf | 2011-06-26 17:27 | 671K | |
![[ ]](/icons/layout.gif) | křížková.pdf | 2011-11-29 10:19 | 669K | |
![[ ]](/icons/layout.gif) | Assays for determination of matrix metalloproteinases and their activity.pdf | 2012-08-17 22:15 | 669K | |
![[ ]](/icons/layout.gif) | Rapid and ultrasensitive method for determination of phytochelatin2 using high performance liquid chromatography with electrochemical detection.pdf | 2011-11-18 15:02 | 668K | |
![[ ]](/icons/layout.gif) | Femtogram Electroanalytical Detection of Prostatic Specific Antigen by Brdicka Reaction.pdf | 2012-03-03 19:53 | 667K | |
![[ ]](/icons/layout.gif) | Beads-Based Electrochemical Assay for the Detection.pdf | 2013-12-13 17:10 | 666K | |
![[ ]](/icons/layout.gif) | Lead toxicosis of captive vultures case description and responses to chelation therapy.pdf | 2013-03-14 23:47 | 661K | |
![[ ]](/icons/layout.gif) | Development of a Magnetic Electrochemical Bar Code Arra.pdf | 2013-07-16 08:04 | 659K | |
![[ ]](/icons/layout.gif) | Utilizing of automated electrophoresis on chip for study of lactoferrin and matrix metalloproteinases.pdf | 2011-11-22 18:04 | 659K | |
![[ ]](/icons/layout.gif) | sensors-09-05040.pdf | 2013-07-05 16:12 | 656K | |
![[ ]](/icons/layout.gif) | Metallomics Study of Lead-Protein Interactions in Albumen by Electrochemical and Electrophoretic Methods.pdf | 2012-02-02 22:05 | 656K | |
![[ ]](/icons/layout.gif) | Quantum Dots for Electrochemical Labelling of Neuramidinase.pdf | 2013-04-05 07:57 | 655K | |
![[ ]](/icons/layout.gif) | Surf_Sci_Rep_published.pdf | 2012-11-30 15:28 | 655K | |
![[ ]](/icons/layout.gif) | Metallothionein Electrochemically Determined using Brdicka Reaction as a Promising Blood Marker of Head and Neck Malignant Tumours.pdf | 2012-03-03 19:53 | 653K | |
![[ ]](/icons/layout.gif) | hanubm.pdf | 2011-06-30 17:53 | 651K | |
![[ ]](/icons/layout.gif) | Beads Based Electrochemical Assay for Detection of Hemagglutinin Labeled by Two Different Types of Cadmium Quantum Dots.pdf | 2014-06-29 13:19 | 649K | |
![[ ]](/icons/layout.gif) | ijerph-11-01715.pdf | 2014-02-10 10:46 | 648K | |
![[ ]](/icons/layout.gif) | LDMR_A_725414_P.pdf | 2012-12-18 23:24 | 646K | |
![[ ]](/icons/layout.gif) | The Effect of Cadmium Ions .pdf | 2015-03-05 16:41 | 641K | |
![[ ]](/icons/layout.gif) | MRT_2011_published.pdf | 2011-08-26 19:25 | 640K | |
![[ ]](/icons/layout.gif) | ijms-10-01138.pdf | 2011-11-24 11:20 | 639K | |
![[ ]](/icons/layout.gif) | Effect of Different Doses of Organically Bound Selenium.pdf | 2013-05-04 13:54 | 632K | |
![[ ]](/icons/layout.gif) | Electrophoretic study of peptide-mediated quantum dot-human immunoglobulin.pdf | 2013-09-15 14:21 | 632K | |
![[ ]](/icons/layout.gif) | The Effect of Cadmium Ions and Cadmium.pdf | 2015-04-05 18:59 | 631K | |
![[ ]](/icons/layout.gif) | Kizek kniha qdtos.pdf | 2012-10-24 08:37 | 629K | |
![[ ]](/icons/layout.gif) | J Nanopart Res (2015) 17423.pdf | 2015-11-09 08:52 | 629K | |
![[ ]](/icons/layout.gif) | Preprocessing and Classification of Electrophoresis Gel Images Using Dynamic Time Warping.pdf | 2013-02-11 08:38 | 628K | |
![[ ]](/icons/layout.gif) | Adam_Electroanal.pdf | 2011-06-30 18:17 | 627K | |
![[ ]](/icons/layout.gif) | D0010A.pdf | 2011-08-26 10:17 | 626K | |
![[ ]](/icons/layout.gif) | Analytical methods for metallothionein detection.pdf | 2011-11-18 16:48 | 626K | |
![[ ]](/icons/layout.gif) | Histone deacetylase inhibitors in cancer therapy. A review.pdf | 2014-07-02 09:38 | 625K | |
![[ ]](/icons/layout.gif) | ijerph-11-07725.pdf | 2014-08-01 08:40 | 617K | |
![[ ]](/icons/layout.gif) | Int J Oncol Vol41 No6 Pg2237.pdf | 2012-10-23 13:20 | 614K | |
![[ ]](/icons/layout.gif) | Analysis of H7N7 Equine Influenza Virus by Spectrometric and Electrochemical Methods.pdf | 2014-06-29 13:19 | 614K | |
![[ ]](/icons/layout.gif) | Adam_CHXVII_6_cl9.pdf | 2011-06-30 18:18 | 613K | |
![[ ]](/icons/layout.gif) | An Adsorptive Transfer Technique Coupled with Brdicka.pdf | 2011-06-26 16:42 | 612K | |
![[ ]](/icons/layout.gif) | 138-12_Sobrova_author.pdf | 2012-12-07 18:57 | 611K | |
![[ ]](/icons/layout.gif) | Sosedka Pegmatite Metal Ions Composition Determined by Voltammetry.pdf | 2013-06-06 14:12 | 607K | |
![[ ]](/icons/layout.gif) | jssc3611.pdf | 2014-11-06 08:22 | 605K | |
![[ ]](/icons/layout.gif) | Effect of Five Different Stages of Ripening on Chemical Compounds in Medlar (Mespilus germanica L.).pdf | 2011-06-26 16:17 | 604K | |
![[ ]](/icons/layout.gif) | P7_Employment of Electrochemical Methods for Assessment of the.pdf | 2014-03-13 10:47 | 598K | |
![[ ]](/icons/layout.gif) | fpls-06-00192.pdf | 2015-04-03 17:42 | 596K | |
![[ ]](/icons/layout.gif) | IJNT 9(8-9) Paper 8.pdf | 2012-03-07 20:20 | 594K | |
![[ ]](/icons/layout.gif) | Adam_sens_08.pdf | 2011-06-26 17:09 | 592K | |
![[ ]](/icons/layout.gif) | kure.pdf | 2015-05-11 14:35 | 590K | |
![[ ]](/icons/layout.gif) | Investigation of the Antioxidant Properties of Metallothionein.pdf | 2011-07-08 17:36 | 590K | |
![[ ]](/icons/layout.gif) | Effects of Various Doses of Selenite on Stinging Nettle (Urtica dioica L.).pdf | 2011-06-26 16:38 | 590K | |
![[ ]](/icons/layout.gif) | Sequences of Pandemic-Causing Viruses Isolated and Detected by Paramagnetic Particles Coupled with Microfluidic System and Electrochemical Detector.pdf | 2013-10-30 07:42 | 579K | |
![[ ]](/icons/layout.gif) | Adam_Sensors.pdf | 2011-06-30 18:20 | 573K | |
![[ ]](/icons/layout.gif) | Electrochemical Study of Doxorubicin Interaction with Different Sequences of Single Stranded Oligonucleotides.pdf | 2012-01-14 21:37 | 570K | |
![[ ]](/icons/layout.gif) | 99909975.pdf | 2015-11-11 14:07 | 569K | |
![[ ]](/icons/layout.gif) | Int J Oncol Vol46 No4 Pg1810.pdf | 2015-02-16 12:35 | 568K | |
![[ ]](/icons/layout.gif) | Acta_Medicinae.pdf | 2014-05-05 09:40 | 567K | |
![[ ]](/icons/layout.gif) | Apis100201249.pdf | 2015-03-03 09:59 | 563K | |
![[ ]](/icons/layout.gif) | KO 2011-04 Kizek.pdf | 2011-09-27 15:46 | 559K | |
![[ ]](/icons/layout.gif) | The Anticancer Drug Ellipticine Induces Cytochromes P450 1A1, 1A2 and 3A, Cytochrome b5 and NADPHCytochrome P450 Oxidoreductase in Rat Liver, Kidney and Lung.pdf | 2013-02-11 08:38 | 559K | |
![[ ]](/icons/layout.gif) | Microfluidic robotic device coupled.pdf | 2011-11-18 14:29 | 558K | |
![[ ]](/icons/unknown.gif) | Metallothionein and low-molecular thiol compounds determination in transgenic tobacco exposed to CdCl2.PDF | 2011-11-22 14:41 | 558K | |
![[ ]](/icons/unknown.gif) | Liquid chromatography with uv detection as a tool for simultaneous detection of nine polycyclic aromatic hydrocarbons (PAHs).PDF | 2011-11-22 14:25 | 556K | |
![[ ]](/icons/layout.gif) | Electrochemical Study of Doxorubicin Interaction with Different Sequences of Double Stranded Oligonucleotides, Part II.pdf | 2012-01-14 21:37 | 554K | |
![[ ]](/icons/unknown.gif) | Comparison of influence of cadmium(II) ions on early somatic embryos of spruce and fir.PDF | 2011-11-21 10:33 | 549K | |
![[ ]](/icons/unknown.gif) | A study of interaction of cadmium(II) ions with cysteine.PDF | 2011-11-22 17:20 | 549K | |
![[ ]](/icons/layout.gif) | Femtogram Electrochemical Sensing of Prion Proteins Using Quantum Dots.pdf | 2013-10-30 07:38 | 548K | |
![[ ]](/icons/layout.gif) | Electrochemical Characterization of PNA Oligonucleotide of Neuraminidase Gene.pdf | 2014-06-29 13:19 | 546K | |
![[ ]](/icons/unknown.gif) | Possibilities of histochemical and microscopical detection of copper in plant tissues.PDF | 2011-11-22 15:31 | 545K | |
![[ ]](/icons/layout.gif) | 2012_11_1075-1080.pdf | 2012-12-07 09:03 | 544K | |
![[ ]](/icons/layout.gif) | Flow Injection Electrochemical Analysis of Complexes of Influenza Proteins with CdS, PbS and CuS Quantum Dots.pdf | 2013-08-06 08:22 | 542K | |
![[ ]](/icons/layout.gif) | Adam_CHL_2008_01_51-58.pdf | 2011-06-26 17:07 | 540K | |
![[ ]](/icons/layout.gif) | 1111209952.pdf | 2015-11-11 14:06 | 538K | |
![[ ]](/icons/layout.gif) | 21stol_01_09.pdf | 2011-06-26 17:01 | 534K | |
![[ ]](/icons/layout.gif) | Oncol Rep Vol31 No4 Pg1846.pdf | 2014-02-27 13:24 | 533K | |
![[ ]](/icons/layout.gif) | CoulArray Detector as a Tool for Estimation of Acute Toxicity of Silver(I) Ions.pdf | 2011-06-26 16:40 | 532K | |
![[ ]](/icons/layout.gif) | asimilace.pdf | 2011-06-30 18:02 | 528K | |
![[ ]](/icons/layout.gif) | 101008243.pdf | 2015-09-14 09:21 | 528K | |
![[ ]](/icons/layout.gif) | Effect of Organic and Inorganic Form of Selenium.pdf | 2012-10-03 11:02 | 523K | |
![[ ]](/icons/layout.gif) | Serum metallothionein in newly diagnosed patients with childhood solid tumours.pdf | 2011-11-22 17:02 | 521K | |
![[ ]](/icons/layout.gif) | ijerph-10-00047.pdf | 2012-12-21 07:55 | 518K | |
![[ ]](/icons/unknown.gif) | Kisek978-1-63483-122-2.pdf.filepart | 2015-08-10 10:45 | 512K | |
![[ ]](/icons/layout.gif) | Remote-Controlled Robotic Platform.pdf | 2015-04-05 19:00 | 506K | |
![[ ]](/icons/layout.gif) | an_analytical_task__a_miniaturized_and_portable_µconductometer_as_a_tool_for_detection_of_pesticides.pdf | 2011-06-26 16:17 | 504K | |
![[ ]](/icons/layout.gif) | materials-07-02242.pdf | 2014-03-18 14:52 | 501K | |
![[ ]](/icons/layout.gif) | Oncol Rep Vol31 No4 Pg1928.pdf | 2014-03-05 17:18 | 497K | |
![[ ]](/icons/layout.gif) | Elektrochemie jako nastroj pro studium interakce matrixove metaloproteinazy-9 a kolagenu.pdf | 2011-11-24 11:07 | 496K | |
![[ ]](/icons/layout.gif) | ENVTOX1420.pdf | 2011-07-11 15:12 | 494K | |
![[ ]](/icons/layout.gif) | Fully Automated Isolation of Proteins Binding Zn from Staphylococcus aureus Cells Using Paramagnetic Particles.pdf | 2013-10-28 17:59 | 492K | |
![[ ]](/icons/layout.gif) | attomole.pdf | 2011-06-30 18:03 | 491K | |
![[ ]](/icons/layout.gif) | Novel biophysical determination of miRNAs related .pdf | 2015-05-11 17:29 | 490K | |
![[ ]](/icons/layout.gif) | Huska_CHXVIII_3_cl2.pdf | 2011-06-26 17:22 | 490K | |
![[ ]](/icons/layout.gif) | 9783642384684-c2.pdf | 2013-09-20 10:17 | 488K | |
![[ ]](/icons/layout.gif) | Methods for carbon nanotubes synthesis-review.pdf | 2011-10-21 11:13 | 486K | |
![[ ]](/icons/layout.gif) | Employment of Electrochemical Methods for Assessment of the.pdf | 2013-04-05 07:58 | 484K | |
![[ ]](/icons/layout.gif) | babulajchb.pdf | 2011-06-30 18:06 | 481K | |
![[ ]](/icons/layout.gif) | Funkcni_vzorek_01_2014.pdf | 2014-01-23 12:12 | 480K | |
![[ ]](/icons/layout.gif) | 100907707.pdf | 2015-09-14 09:20 | 476K | |
![[ ]](/icons/layout.gif) | Accumulation of Cadmium by Transgenic Tobacco Plants (Nicotiana tabacum L.) Carrying Yeast Metallothionein Gene Revealed by Electrochemistry.pdf | 2012-02-02 22:05 | 474K | |
![[ ]](/icons/layout.gif) | Exp Ther Med Vol5 No2 Pg479.pdf | 2012-12-14 17:02 | 472K | |
![[ ]](/icons/layout.gif) | Study of Metallothionein Role in Spinocellular Carcinoma Tissues of Head and Neck Tumours using Brdicka Reaction.pdf | 2012-03-03 19:55 | 472K | |
![[ ]](/icons/layout.gif) | 0604ch.pdf | 2011-06-30 18:01 | 469K | |
![[ ]](/icons/layout.gif) | sevcikova 2015.pdf | 2015-09-15 15:53 | 469K | |
![[ ]](/icons/layout.gif) | Oncol Lett Vol4 No6 Pg1247.pdf | 2012-09-29 22:52 | 469K | |
![[ ]](/icons/layout.gif) | Funkcni_vzorek_03_2014.pdf | 2014-01-23 12:13 | 467K | |
![[ ]](/icons/layout.gif) | Electrophoretic fingerprint metallothionein.pdf | 2011-07-26 12:30 | 464K | |
![[ ]](/icons/layout.gif) | Electrochemical Biosensor Based on Acetylcholinesterase and Indoxylacetate for Assay of Neurotoxic Compounds Represented by Paraoxon.pdf | 2012-01-14 21:37 | 460K | |
![[ ]](/icons/layout.gif) | Huska_ELFO_09.pdf | 2011-06-26 17:21 | 459K | |
![[ ]](/icons/layout.gif) | Prostate Cancer, miRNAs, Metallothioneins and Resistance to Cytostatic Drugs.pdf | 2013-01-21 20:28 | 456K | |
![[ ]](/icons/layout.gif) | Int J Oncol Vol43 No6 Pg1754.pdf | 2013-10-21 14:14 | 456K | |
![[ ]](/icons/layout.gif) | clanek_unor_2014.pdf | 2014-02-01 19:42 | 453K | |
![[ ]](/icons/layout.gif) | Comparison of metallothionein detection by using of Brdicka reaction and enzyme-linked immunosorbent assay employing chicken yolk antibodies.pdf | 2011-11-23 15:42 | 452K | |
![[ ]](/icons/layout.gif) | renenano.pdf | 2013-03-27 13:55 | 452K | |
![[ ]](/icons/layout.gif) | Electroanal_Adam.pdf | 2011-06-30 18:24 | 451K | |
![[ ]](/icons/layout.gif) | pdp2.pdf | 2015-02-13 15:20 | 450K | |
![[ ]](/icons/layout.gif) | Kizek from 978-1-62081-914-2.pdf | 2013-02-26 23:50 | 449K | |
![[ ]](/icons/layout.gif) | pospPUB2015.pdf | 2015-05-26 09:05 | 448K | |
![[ ]](/icons/layout.gif) | estudy.pdf | 2011-06-30 18:09 | 439K | |
![[ ]](/icons/layout.gif) | Fully Automated Spectrometric Protocols for Determination.pdf | 2011-06-26 16:51 | 437K | |
![[ ]](/icons/layout.gif) | Paramagnetic antibody-modified microparticles coupled with voltammetry.pdf | 2011-10-21 10:54 | 435K | |
![[ ]](/icons/layout.gif) | Voltammetry Assay for Assessment of Oxidative Stress linked Pathologies in Brain Tumor suffered Childhood Patients.pdf | 2012-12-03 11:46 | 435K | |
![[ ]](/icons/layout.gif) | TRAC13516.pdf | 2011-06-26 16:57 | 432K | |
![[ ]](/icons/layout.gif) | From Na_K_ATPase and cardiac glycosides to cytotoxicity and cancer treatment.pdf | 2013-11-22 14:57 | 430K | |
![[ ]](/icons/layout.gif) | 0013-Petr Babula.pdf | 2013-11-25 13:47 | 430K | |
![[ ]](/icons/layout.gif) | 91005675.pdf | 2014-10-23 10:53 | 429K | |
![[ ]](/icons/layout.gif) | Chromatographia_Mikelova.pdf | 2011-06-26 17:25 | 427K | |
![[ ]](/icons/layout.gif) | 310983_1_En_25_Chapter_OnlinePDF.pdf | 2014-11-15 19:42 | 427K | |
![[ ]](/icons/layout.gif) | Chronopotentiometric Stripping Analysis of Gelatinase B, Collagen and Their Interaction.pdf | 2011-11-24 11:34 | 426K | |
![[ ]](/icons/layout.gif) | Chromatographia_Krizkova.pdf | 2011-06-26 17:24 | 416K | |
![[ ]](/icons/layout.gif) | Use of brightness wavelet transformation for automated analysis of serum metallothioneins- and zinc-containing proteins by Western blots to subclassify childhood solid tumours.pdf | 2013-06-06 13:50 | 410K | |
![[ ]](/icons/layout.gif) | P11_Electrochemical Tools for Determination of Phenolic.pdf | 2014-03-13 10:48 | 404K | |
![[ ]](/icons/layout.gif) | mikrofluidika_2.pdf | 2012-12-28 12:22 | 404K | |
![[ ]](/icons/layout.gif) | Tularemia progression accompanied with oxidative stress and antioxidant alteration in spleen and liver of BALBc mice.pdf | 2012-07-26 13:32 | 402K | |
![[ ]](/icons/layout.gif) | Funkcni_vzorek_02_2014.pdf | 2014-01-23 12:13 | 401K | |
![[ ]](/icons/layout.gif) | Gumulec_2011.pdf | 2011-08-22 16:53 | 397K | |
![[ ]](/icons/layout.gif) | lc4-2008.pdf | 2011-06-26 17:34 | 396K | |
![[ ]](/icons/layout.gif) | Optimization-of-Laser-Induced-Breakdown-Spectroscopy-LIBS-for-Determination-of-Quantum-Dots-Qds-in-Liquid-Solutions.pdf | 2013-12-16 10:06 | 395K | |
![[ ]](/icons/layout.gif) | elps201470120.pdf | 2014-07-14 11:47 | 395K | |
![[ ]](/icons/layout.gif) | elps5087.pdf | 2014-07-14 11:47 | 395K | |
![[ ]](/icons/layout.gif) | 0067-14_Milosavljevic_author.pdf | 2014-12-07 16:15 | 395K | |
![[ ]](/icons/layout.gif) | Self-ordered TiO2 quantum dot array prepared via anodic oxidation.pdf | 2012-03-13 19:08 | 394K | |
![[ ]](/icons/layout.gif) | NEL341013A19_Heger_p123-129.pdf | 2014-01-07 13:19 | 393K | |
![[ ]](/icons/layout.gif) | clanek128.pdf | 2015-08-13 10:02 | 392K | |
![[ ]](/icons/layout.gif) | 100907440.pdf | 2015-11-09 09:14 | 392K | |
![[ ]](/icons/layout.gif) | Effect of Metals on Metallothionein Content in Fish from Skalka and Zelivka Reservoirs.pdf | 2013-02-11 08:38 | 381K | |
![[ ]](/icons/layout.gif) | Electrochemical Microarray for Identification Pathogens A Review.pdf | 2014-06-29 13:20 | 381K | |
![[ ]](/icons/layout.gif) | Electrochemical Sensors and Biosensors for Influenza Detection - Literature Survey 2012-2013.pdf | 2014-07-02 09:37 | 379K | |
![[ ]](/icons/layout.gif) | 4-babula_PSE_53_350-354.pdf | 2011-06-30 18:14 | 379K | |
![[ ]](/icons/layout.gif) | 024-029.pdf | 2012-12-17 10:03 | 378K | |
![[ ]](/icons/layout.gif) | The Synergistic Effects of DNA-Targeted Chemotherapeutics and Histone Deacetylase Inhibitors As Therapeutic Strategies for Cancer Treatment.pdf | 2012-10-16 22:37 | 376K | |
![[ ]](/icons/layout.gif) | 107637266.pdf | 2013-08-05 12:13 | 375K | |
![[ ]](/icons/layout.gif) | Neo_2_12_25_Gumulec proof_Revised.pdf | 2012-01-27 22:11 | 372K | |
![[ ]](/icons/layout.gif) | Integrated chip electrophoresis and magnetic particle isolation used for detection of hepatitis B virus oligonucleotides.pdf | 2013-06-06 14:07 | 369K | |
![[ ]](/icons/layout.gif) | 194-11 Rop_finall.pdf | 2012-08-22 12:15 | 364K | |
![[ ]](/icons/layout.gif) | glut100201716.pdf | 2015-03-03 10:00 | 357K | |
![[ ]](/icons/layout.gif) | Electrochemical Investigation of Strontium-Metallothionein Interactions - Analysis of Serum and Urine of Patients with Osteoporosis.pdf | 2011-11-24 11:01 | 354K | |
![[ ]](/icons/layout.gif) | Magnetic nanoparticles and targeted drug delivering.pdf | 2011-06-26 16:52 | 350K | |
![[ ]](/icons/layout.gif) | mikelovabm.pdf | 2011-06-30 17:54 | 346K | |
![[ ]](/icons/layout.gif) | Effects of Reduced Glutathione, Surface Active Agents, and Ionic Strength on the Detection of Metallothioneins by Using of Brdicka Reaction.pdf | 2011-11-24 10:28 | 342K | |
![[ ]](/icons/layout.gif) | From Amino Acids to Proteins as Targets for Metal-based Drugs.pdf | 2012-03-19 20:34 | 339K | |
![[ ]](/icons/layout.gif) | HIV Biosensors - The Potential of the Electrochemical Way.pdf | 2014-06-29 13:20 | 337K | |
![[ ]](/icons/layout.gif) | babulabm.pdf | 2011-06-30 17:52 | 337K | |
![[ ]](/icons/layout.gif) | kapitola-1.pdf | 2012-06-13 21:41 | 334K | |
![[ ]](/icons/layout.gif) | Electrochemical Study of Ellipticine Interaction with Single and Double Stranded Oligonucleotides.pdf | 2014-02-12 07:38 | 330K | |
![[ ]](/icons/layout.gif) | Determination of content of metallothionein and low molecular mass stress peptides in transgenic tobacco plants.pdf | 2011-12-01 16:06 | 326K | |
![[ ]](/icons/layout.gif) | Voltammetry of Adiponectin and its Interactions with Collagen on a Carbon Paste Electrode at Femtogram Level.pdf | 2012-01-14 21:37 | 326K | |
![[ ]](/icons/layout.gif) | 30-32.pdf | 2011-06-30 18:00 | 325K | |
![[ ]](/icons/layout.gif) | Qualities of native apple cultivar juices characteristic of Central Europe.pdf | 2012-05-16 01:29 | 321K | |
![[ ]](/icons/layout.gif) | Serum Metallothioneins in Childhood Tumours-A Potential.pdf | 2013-06-07 07:13 | 319K | |
![[ ]](/icons/layout.gif) | KO 2013-04_blazkova_lock.pdf | 2013-10-30 07:19 | 315K | |
![[ ]](/icons/layout.gif) | Evaluation of alpha-methylacyl-CoA racemase, metallothionein and prostate specific antigen as prostate cancer progn.pdf | 2012-01-29 21:03 | 310K | |
![[ ]](/icons/layout.gif) | phage-capsid-for-efficient-delivery-of-cytotoxic-drugs.pdf | 2015-11-26 15:23 | 309K | |
![[ ]](/icons/layout.gif) | Vysokonapetovy zdroj pro mikrofluidni mereni.pdf | 2012-12-28 12:24 | 294K | |
![[ ]](/icons/layout.gif) | Fabrik_CHXVIII_3_cl2.pdf | 2011-06-26 17:20 | 286K | |
![[ ]](/icons/layout.gif) | Blazkova_doxo.pdf | 2012-10-09 15:34 | 281K | |
![[ ]](/icons/layout.gif) | Hodek_CBI_09.pdf | 2011-11-24 11:32 | 274K | |
![[ ]](/icons/layout.gif) | 0120-14_Heger_author.pdf | 2014-12-07 16:16 | 266K | |
![[ ]](/icons/layout.gif) | Acta Medica_1_2015_05.pdf | 2015-06-05 10:58 | 265K | |
![[ ]](/icons/layout.gif) | Chip gel electrophoresis as a tool for study of matrix metalloproteinase.pdf | 2011-11-18 13:57 | 264K | |
![[ ]](/icons/layout.gif) | Improvement of electrophoresis performance.pdf | 2012-08-04 16:10 | 264K | |
![[ ]](/icons/layout.gif) | Libuse Trnkova - Founder of Elimination Voltammetry.pdf | 2013-04-05 07:56 | 264K | |
![[ ]](/icons/layout.gif) | Carbofuran assay using gelatin based biosensor with acetylcholinesterase as a recognition element.pdf | 2013-01-04 18:17 | 262K | |
![[ ]](/icons/layout.gif) | Beklova_liska.pdf | 2011-06-30 18:22 | 261K | |
![[ ]](/icons/layout.gif) | Projekt_Definitivni.pdf | 2013-04-05 07:56 | 254K | |
![[ ]](/icons/layout.gif) | Cisplatin.pdf | 2011-06-30 18:08 | 241K | |
![[ ]](/icons/layout.gif) | How Do Grass Species, Season and Ensiling Influence Mycotoxin Content in Forage.pdf | 2013-11-13 08:12 | 237K | |
![[ ]](/icons/layout.gif) | The dependence of adenine isolation efficiency on the chain length evidenced using paramagnetic particles and voltammetry measurements.pdf | 2011-11-23 17:27 | 235K | |
![[ ]](/icons/layout.gif) | Adam_Sensors_MT.pdf | 2011-06-30 18:20 | 235K | |
![[ ]](/icons/layout.gif) | Clinical_importance_MMP.pdf | 2011-07-26 12:09 | 233K | |
![[ ]](/icons/layout.gif) | Analysis of covalent ellipticine- and doxorubicin-derived adducts in DNA.pdf | 2012-08-09 14:44 | 232K | |
![[ ]](/icons/layout.gif) | Polyphenolic Profile and Biological Activity of Chinese Hawthorn.pdf | 2012-12-06 12:45 | 231K | |
![[ ]](/icons/layout.gif) | uv023748.pdf | 2013-03-29 08:16 | 227K | |
![[ ]](/icons/layout.gif) | NEL300709A28_Vasatkova.pdf | 2011-06-26 16:59 | 227K | |
![[ ]](/icons/layout.gif) | 2014_01_56-63.pdf | 2014-03-24 15:29 | 226K | |
![[ ]](/icons/layout.gif) | Diopan_Listu Cukrov Rep_Hydroponics and its importance for phytoremediation technologies.pdf | 2011-11-24 11:11 | 222K | |
![[ ]](/icons/layout.gif) | An Acetylcholinesterase-Based Chronoamperometric Biosensor.pdf | 2013-08-30 12:27 | 216K | |
![[ ]](/icons/layout.gif) | Ion Exchange Chromatography and Mass Spectrometric.pdf | 2013-03-28 23:29 | 215K | |
![[ ]](/icons/layout.gif) | Evaluation of Polyphenolic Profile and Nutritional Value of Non-Traditional Fruit Species in the Czech Republic - A Comparative Study.pdf | 2012-07-27 14:17 | 214K | |
![[ ]](/icons/layout.gif) | MT_FONS1.pdf | 2011-12-01 15:21 | 213K | |
![[ ]](/icons/layout.gif) | Electrophoresis 2'2012.pdf | 2012-01-14 21:37 | 211K | |
![[ ]](/icons/layout.gif) | NEL300709A29_Kovarova.pdf | 2011-06-26 17:00 | 210K | |
![[ ]](/icons/layout.gif) | S024812941300087Xa.pdf | 2013-10-07 11:31 | 210K | |
![[ ]](/icons/layout.gif) | Nanoporezni elektroda.pdf | 2012-12-28 16:00 | 205K | |
![[ ]](/icons/layout.gif) | uv023548.pdf | 2013-03-29 08:16 | 198K | |
![[ ]](/icons/layout.gif) | Effect of Cadmium Chloride on Metallothionein Levels in Carp.pdf | 2011-11-24 10:05 | 195K | |
![[ ]](/icons/layout.gif) | 10102-Volume4_Issue_2-06_paper.pdf | 2011-11-18 16:12 | 193K | |
![[ ]](/icons/layout.gif) | 012pet.pdf | 2011-06-30 17:50 | 192K | |
![[ ]](/icons/layout.gif) | lpr_cerven.pdf | 2014-07-25 21:34 | 188K | |
![[ ]](/icons/layout.gif) | 21stol6.pdf | 2011-06-30 17:58 | 184K | |
![[ ]](/icons/layout.gif) | fabrik.pdf | 2011-06-26 17:17 | 181K | |
![[ ]](/icons/layout.gif) | 3-petrlova_PSE_53_345-349.pdf | 2011-06-30 18:13 | 174K | |
![[ ]](/icons/layout.gif) | Nanostrukturovana pracovni elektroda.pdf | 2012-12-28 12:23 | 158K | |
![[ ]](/icons/layout.gif) | Zarizeni pro temperovani mikrofluidnich cipu.pdf | 2012-12-28 12:27 | 158K | |
![[ ]](/icons/layout.gif) | Carboplatin.pdf | 2011-06-26 17:16 | 149K | |
![[ ]](/icons/layout.gif) | Babula_sensor.pdf | 2011-06-30 18:05 | 145K | |
![[ ]](/icons/layout.gif) | sperm_Stejskal.pdf | 2011-12-01 15:55 | 143K | |
![[ ]](/icons/layout.gif) | automat mereni.pdf | 2012-12-28 12:19 | 141K | |
![[ ]](/icons/layout.gif) | NEL341013A20_Kominkova_p130-133.pdf | 2014-01-07 13:19 | 135K | |
![[ ]](/icons/layout.gif) | KBM_3-08_Kukacka_161.pdf | 2011-12-01 15:35 | 134K | |
![[ ]](/icons/layout.gif) | poloautomaticka anodizacni stanice.pdf | 2012-12-28 12:23 | 132K | |
![[ ]](/icons/layout.gif) | Zalivaci forma pro vyrobu elektrod.pdf | 2012-12-28 12:21 | 121K | |
![[ ]](/icons/layout.gif) | Journal of Food Quality-msc.pdf | 2011-07-08 17:42 | 104K | |
![[ ]](/icons/layout.gif) | 21stol.pdf | 2011-06-30 17:57 | 103K | |
![[ ]](/icons/layout.gif) | tisteny senzor.pdf | 2012-12-28 15:57 | 102K | |
![[ ]](/icons/layout.gif) | 203-207.pdf | 2014-04-01 15:57 | 86K | |
![[IMG]](/icons/image2.gif) | cda_displayimage016.jpg | 2013-05-27 11:44 | 70K | |
![[ ]](/icons/layout.gif) | 9783642384684-t1.pdf | 2013-09-20 10:17 | 45K | |
![[IMG]](/icons/image2.gif) | th_Anti_Cancer_Agents_Med_Chem.gif | 2013-11-25 13:47 | 29K | |
![[ ]](/icons/layout.gif) | 05prusa2.pdf | 2011-06-30 17:48 | 27K | |
![[ ]](/icons/layout.gif) | 05prusa1.pdf | 2011-06-30 17:22 | 25K | |
![[IMG]](/icons/image2.gif) | cover2015.jpg | 2015-04-05 19:00 | 19K | |
![[IMG]](/icons/image2.gif) | eu.png | 2015-05-11 14:35 | 13K | |
![[IMG]](/icons/image2.gif) | ijerph-logo.png | 2013-12-03 12:02 | 6.0K | |
![[DIR]](/icons/folder.gif) | obalky/ | 2015-12-07 11:26 | - | |
|